C15H19N5O4S2 — CID 133276246
5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzenesulfonamide (PubChem CID 133276246) has the molecular formula C15H19N5O4S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzenesulfonamide.
| Compound Name | 5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 133276246 |
| Molecular Formula | C15H19N5O4S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 5-nitro-2-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CCCN(Cc2cscn2)CC1 |
| InChI | InChI=1S/C15H19N5O4S2/c16-26(23,24)15-8-13(20(21)22)2-3-14(15)19-5-1-4-18(6-7-19)9-12-10-25-11-17-12/h2-3,8,10-11H,1,4-7,9H2,(H2,16,23,24) |
| InChIKey | MIRWNYULCYGJHQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|