C12H17N3O5S — CID 78782987
2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzenesulfonamide (PubChem CID 78782987) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 78782987 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-5-nitrobenzenesulfonamide |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2S(N)(=O)=O)CC(C)O1 |
| InChI | InChI=1S/C12H17N3O5S/c1-8-6-14(7-9(2)20-8)11-4-3-10(15(16)17)5-12(11)21(13,18)19/h3-5,8-9H,6-7H2,1-2H3,(H2,13,18,19) |
| InChIKey | OVUFBCRNPQJHME-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|