C20H33N3O5S — CID 2921743
2-(2,6-dimethylmorpholin-4-yl)-N,N-bis(2-methylpropyl)-5-nitrobenzenesulfonamide (PubChem CID 2921743) has the molecular formula C20H33N3O5S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N,N-bis(2-methylpropyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N,N-bis(2-methylpropyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2921743 |
| Molecular Formula | C20H33N3O5S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N,N-bis(2-methylpropyl)-5-nitrobenzenesulfonamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H33N3O5S/c1-14(2)10-22(11-15(3)4)29(26,27)20-9-18(23(24)25)7-8-19(20)21-12-16(5)28-17(6)13-21/h7-9,14-17H,10-13H2,1-6H3 |
| InChIKey | BBSNHTAYEHBSKS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|