C14H20N2O3 — CID 100804874
(2S,6R)-4-(2-ethyl-4-nitrophenyl)-2,6-dimethylmorpholine (PubChem CID 100804874) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2S,6R)-4-(2-ethyl-4-nitrophenyl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(2-ethyl-4-nitrophenyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 100804874 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2S,6R)-4-(2-ethyl-4-nitrophenyl)-2,6-dimethylmorpholine |
| SMILES | CCc1cc([N+](=O)[O-])ccc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H20N2O3/c1-4-12-7-13(16(17)18)5-6-14(12)15-8-10(2)19-11(3)9-15/h5-7,10-11H,4,8-9H2,1-3H3/t10-,11+ |
| InChIKey | YGZBQPVGCXRSOS-PHIMTYICSA-N |
| XLogP | 2.77 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|