C13H17ClN2O4 — CID 103535532
1-[2-(chloromethyl)-4-nitrophenyl]-3,4-dimethoxypyrrolidine (PubChem CID 103535532) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-4-nitrophenyl]-3,4-dimethoxypyrrolidine.
| Compound Name | 1-[2-(chloromethyl)-4-nitrophenyl]-3,4-dimethoxypyrrolidine |
|---|---|
| PubChem CID | 103535532 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-[2-(chloromethyl)-4-nitrophenyl]-3,4-dimethoxypyrrolidine |
| SMILES | COC1CN(c2ccc([N+](=O)[O-])cc2CCl)CC1OC |
| InChI | InChI=1S/C13H17ClN2O4/c1-19-12-7-15(8-13(12)20-2)11-4-3-10(16(17)18)5-9(11)6-14/h3-5,12-13H,6-8H2,1-2H3 |
| InChIKey | JIGQOKGSOIFBIM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|