C11H14N2O5 — CID 58386081
(3S,4S)-1-(2-methoxy-4-nitrophenyl)pyrrolidine-3,4-diol (PubChem CID 58386081) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is (3S,4S)-1-(2-methoxy-4-nitrophenyl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4S)-1-(2-methoxy-4-nitrophenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 58386081 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (3S,4S)-1-(2-methoxy-4-nitrophenyl)pyrrolidine-3,4-diol |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H14N2O5/c1-18-11-4-7(13(16)17)2-3-8(11)12-5-9(14)10(15)6-12/h2-4,9-10,14-15H,5-6H2,1H3/t9-,10-/m0/s1 |
| InChIKey | FYZZYEBGHCYRDB-UWVGGRQHSA-N |
| XLogP | 0.15 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|