C19H31N3O4 — CID 129181102
3-[[1-(2-methoxy-4-nitrophenyl)piperidin-4-yl]amino]-2,4-dimethylpentan-2-ol (PubChem CID 129181102) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is 3-[[1-(2-methoxy-4-nitrophenyl)piperidin-4-yl]amino]-2,4-dimethylpentan-2-ol.
| Compound Name | 3-[[1-(2-methoxy-4-nitrophenyl)piperidin-4-yl]amino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 129181102 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 3-[[1-(2-methoxy-4-nitrophenyl)piperidin-4-yl]amino]-2,4-dimethylpentan-2-ol |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1CCC(NC(C(C)C)C(C)(C)O)CC1 |
| InChI | InChI=1S/C19H31N3O4/c1-13(2)18(19(3,4)23)20-14-8-10-21(11-9-14)16-7-6-15(22(24)25)12-17(16)26-5/h6-7,12-14,18,20,23H,8-11H2,1-5H3 |
| InChIKey | BUAVVBNNRBLIOL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|