C13H18N2O6S — CID 156665043
[3,3,5,5-tetradeuterio-1-(2-methoxy-4-nitrophenyl)piperidin-4-yl] methanesulfonate (PubChem CID 156665043) has the molecular formula C13H18N2O6S and a molecular weight of 334.39 g/mol. Its IUPAC name is [3,3,5,5-tetradeuterio-1-(2-methoxy-4-nitrophenyl)piperidin-4-yl] methanesulfonate.
| Compound Name | [3,3,5,5-tetradeuterio-1-(2-methoxy-4-nitrophenyl)piperidin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 156665043 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [3,3,5,5-tetradeuterio-1-(2-methoxy-4-nitrophenyl)piperidin-4-yl] methanesulfonate |
| SMILES | [2H]C1([2H])CN(c2ccc([N+](=O)[O-])cc2OC)CC([2H])([2H])C1OS(C)(=O)=O |
| InChI | InChI=1S/C13H18N2O6S/c1-20-13-9-10(15(16)17)3-4-12(13)14-7-5-11(6-8-14)21-22(2,18)19/h3-4,9,11H,5-8H2,1-2H3/i5D2,6D2 |
| InChIKey | WQJRQEFDGWNSQK-NZLXMSDQSA-N |
| XLogP | 1.55 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|