C23H29N5O9 — CID 59006096
(2,4-dinitrophenyl)-[3-methoxy-4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene (PubChem CID 59006096) has the molecular formula C23H29N5O9 and a molecular weight of 519.51 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-[3-methoxy-4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene.
| Compound Name | (2,4-dinitrophenyl)-[3-methoxy-4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene |
|---|---|
| PubChem CID | 59006096 |
| Molecular Formula | C23H29N5O9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (2,4-dinitrophenyl)-[3-methoxy-4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]diazene |
| SMILES | COc1cc(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1N1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C23H29N5O9/c1-33-23-16-18(24-25-20-4-3-19(27(29)30)17-22(20)28(31)32)2-5-21(23)26-6-8-34-10-12-36-14-15-37-13-11-35-9-7-26/h2-5,16-17H,6-15H2,1H3/b25-24+ |
| InChIKey | YPXGQARLQRKYJN-OCOZRVBESA-N |
| XLogP | 3.81 |
| TPSA | 160.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|