C15H20N4O5 — CID 126836069
4-[1-(2,4-dinitrophenyl)piperidin-4-yl]morpholine (PubChem CID 126836069) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-[1-(2,4-dinitrophenyl)piperidin-4-yl]morpholine.
| Compound Name | 4-[1-(2,4-dinitrophenyl)piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 126836069 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[1-(2,4-dinitrophenyl)piperidin-4-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(N3CCOCC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20N4O5/c20-18(21)13-1-2-14(15(11-13)19(22)23)17-5-3-12(4-6-17)16-7-9-24-10-8-16/h1-2,11-12H,3-10H2 |
| InChIKey | ZDMDIWSEEOUYKG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|