C17H16N6O7 — CID 126011066
N-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,4-dinitroaniline (PubChem CID 126011066) has the molecular formula C17H16N6O7 and a molecular weight of 416.35 g/mol. Its IUPAC name is N-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 126011066 |
| Molecular Formula | C17H16N6O7 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[(E)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N6O7/c24-21(25)13-2-3-14(16(10-13)22(26)27)19-18-11-12-1-4-15(17(9-12)23(28)29)20-5-7-30-8-6-20/h1-4,9-11,19H,5-8H2/b18-11+ |
| InChIKey | ADMQBJLEJMWIIB-WOJGMQOQSA-N |
| XLogP | 2.69 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|