C25H24N4O5 — CID 126027173
2-hydroxy-N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 126027173) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126027173 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-hydroxy-N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N4O5/c30-24(25(31,20-7-3-1-4-8-20)21-9-5-2-6-10-21)27-26-18-19-11-12-22(23(17-19)29(32)33)28-13-15-34-16-14-28/h1-12,17-18,31H,13-16H2,(H,27,30)/b26-18- |
| InChIKey | QUTIBFXWSAWZAC-ITYLOYPMSA-N |
| XLogP | 2.82 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|