C24H24ClN5O4 — CID 126018279
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]benzamide (PubChem CID 126018279) has the molecular formula C24H24ClN5O4 and a molecular weight of 481.94 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126018279 |
| Molecular Formula | C24H24ClN5O4 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(Cl)c(C(=O)NN=Cc2ccc(N3CCOCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H24ClN5O4/c1-16-3-4-17(2)29(16)19-6-7-21(25)20(14-19)24(31)27-26-15-18-5-8-22(23(13-18)30(32)33)28-9-11-34-12-10-28/h3-8,13-15H,9-12H2,1-2H3,(H,27,31) |
| InChIKey | ICWGGGHKCSIZMM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|