C16H14Cl2N4O3 — CID 9261042
2,5-dichloro-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide (PubChem CID 9261042) has the molecular formula C16H14Cl2N4O3 and a molecular weight of 381.22 g/mol. Its IUPAC name is 2,5-dichloro-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide.
| Compound Name | 2,5-dichloro-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9261042 |
| Molecular Formula | C16H14Cl2N4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2,5-dichloro-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]benzamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)c2cc(Cl)ccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14Cl2N4O3/c1-21(2)14-6-3-10(7-15(14)22(24)25)9-19-20-16(23)12-8-11(17)4-5-13(12)18/h3-9H,1-2H3,(H,20,23)/b19-9- |
| InChIKey | AKCHPWWKWREVTE-OCKHKDLRSA-N |
| XLogP | 3.73 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|