C14H10ClN3O5 — CID 764254
N-[(4-chloro-3-nitrophenyl)methylideneamino]-2,4-dihydroxybenzamide (PubChem CID 764254) has the molecular formula C14H10ClN3O5 and a molecular weight of 335.70 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methylideneamino]-2,4-dihydroxybenzamide.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methylideneamino]-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 764254 |
| Molecular Formula | C14H10ClN3O5 |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methylideneamino]-2,4-dihydroxybenzamide |
| SMILES | O=C(NN=Cc1ccc(Cl)c([N+](=O)[O-])c1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H10ClN3O5/c15-11-4-1-8(5-12(11)18(22)23)7-16-17-14(21)10-3-2-9(19)6-13(10)20/h1-7,19-20H,(H,17,21) |
| InChIKey | VLFCISRRIFVYML-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|