C17H17ClN4O4 — CID 9257149
2-(4-chlorophenoxy)-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]acetamide (PubChem CID 9257149) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9257149 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]acetamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)COc2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17ClN4O4/c1-21(2)15-8-3-12(9-16(15)22(24)25)10-19-20-17(23)11-26-14-6-4-13(18)5-7-14/h3-10H,11H2,1-2H3,(H,20,23)/b19-10- |
| InChIKey | VVCZUKKPLDUBDD-GRSHGNNSSA-N |
| XLogP | 2.84 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|