C17H15Br3N4O4 — CID 6229195
N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 6229195) has the molecular formula C17H15Br3N4O4 and a molecular weight of 579.04 g/mol. Its IUPAC name is N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 6229195 |
| Molecular Formula | C17H15Br3N4O4 |
| Molecular Weight | 579.04 g/mol |
| Exact Mass | 575.86 |
| IUPAC Name | N-[(Z)-[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)COc2c(Br)cc(Br)cc2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15Br3N4O4/c1-23(2)14-4-3-10(5-15(14)24(26)27)8-21-22-16(25)9-28-17-12(19)6-11(18)7-13(17)20/h3-8H,9H2,1-2H3,(H,22,25)/b21-8- |
| InChIKey | WMRGHPLKGJFBDA-WNFQYIGGSA-N |
| XLogP | 4.48 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.04 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|