C19H17Br3N4O4 — CID 16760828
N-[(E)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 16760828) has the molecular formula C19H17Br3N4O4 and a molecular weight of 605.08 g/mol. Its IUPAC name is N-[(E)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 16760828 |
| Molecular Formula | C19H17Br3N4O4 |
| Molecular Weight | 605.08 g/mol |
| Exact Mass | 601.88 |
| IUPAC Name | N-[(E)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N/N=C/c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17Br3N4O4/c20-13-8-14(21)19(15(22)9-13)30-11-18(27)24-23-10-12-3-4-16(17(7-12)26(28)29)25-5-1-2-6-25/h3-4,7-10H,1-2,5-6,11H2,(H,24,27)/b23-10+ |
| InChIKey | DGGPTSKHZTUJDH-AUEPDCJTSA-N |
| XLogP | 5.01 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.08 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|