C15H10Br3IN2O3 — CID 135679327
N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 135679327) has the molecular formula C15H10Br3IN2O3 and a molecular weight of 632.87 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 135679327 |
| Molecular Formula | C15H10Br3IN2O3 |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 629.73 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-iodophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N/N=C/c1ccc(O)c(I)c1 |
| InChI | InChI=1S/C15H10Br3IN2O3/c16-9-4-10(17)15(11(18)5-9)24-7-14(23)21-20-6-8-1-2-13(22)12(19)3-8/h1-6,22H,7H2,(H,21,23)/b20-6+ |
| InChIKey | FOLBFPRGCAJDRQ-CGOBSMCZSA-N |
| XLogP | 4.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|