C15H10Br3N3O5 — CID 3823669
N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 3823669) has the molecular formula C15H10Br3N3O5 and a molecular weight of 551.97 g/mol. Its IUPAC name is N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 3823669 |
| Molecular Formula | C15H10Br3N3O5 |
| Molecular Weight | 551.97 g/mol |
| Exact Mass | 548.82 |
| IUPAC Name | N-[(4-hydroxy-3-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)NN=Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10Br3N3O5/c16-9-4-10(17)15(11(18)5-9)26-7-14(23)20-19-6-8-1-2-13(22)12(3-8)21(24)25/h1-6,22H,7H2,(H,20,23) |
| InChIKey | UAZLRPVCCNWZQU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|