C13H8Br3N3O5 — CID 6885676
N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 6885676) has the molecular formula C13H8Br3N3O5 and a molecular weight of 525.94 g/mol. Its IUPAC name is N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 6885676 |
| Molecular Formula | C13H8Br3N3O5 |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 522.80 |
| IUPAC Name | N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)N/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H8Br3N3O5/c14-7-3-9(15)13(10(16)4-7)23-6-11(20)18-17-5-8-1-2-12(24-8)19(21)22/h1-5H,6H2,(H,18,20)/b17-5+ |
| InChIKey | IPKFEMKIJBXFJN-YAXRCOADSA-N |
| XLogP | 4.00 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|