C20H20N8O3 — CID 6219660
N-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 6219660) has the molecular formula C20H20N8O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is N-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6219660 |
| Molecular Formula | C20H20N8O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(Z)-(3-nitro-4-pyrrolidin-1-ylphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N/N=C\c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N8O3/c29-19(14-27-24-20(23-25-27)16-6-2-1-3-7-16)22-21-13-15-8-9-17(18(12-15)28(30)31)26-10-4-5-11-26/h1-3,6-9,12-13H,4-5,10-11,14H2,(H,22,29)/b21-13- |
| InChIKey | RIPQDNGIZYOXLS-BKUYFWCQSA-N |
| XLogP | 2.00 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|