C22H19N7O4 — CID 1079442
N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 1079442) has the molecular formula C22H19N7O4 and a molecular weight of 445.44 g/mol. Its IUPAC name is N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1079442 |
| Molecular Formula | C22H19N7O4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | Cc1cc(-c2ccc(C=NNC(=O)Cn3nnc(-c4ccccc4)n3)o2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H19N7O4/c1-14-10-18(19(29(31)32)11-15(14)2)20-9-8-17(33-20)12-23-24-21(30)13-28-26-22(25-27-28)16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,24,30) |
| InChIKey | UTZGLOKUWUNPGB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|