C27H20N4O5 — CID 26368133
N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 26368133) has the molecular formula C27H20N4O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 26368133 |
| Molecular Formula | C27H20N4O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[(Z)-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)Cn3c4ccccc4c(=O)c4ccccc43)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H20N4O5/c1-17-10-11-18(14-24(17)31(34)35)25-13-12-19(36-25)15-28-29-26(32)16-30-22-8-4-2-6-20(22)27(33)21-7-3-5-9-23(21)30/h2-15H,16H2,1H3,(H,29,32)/b28-15- |
| InChIKey | VTZWLEQDHMEVFG-MBTHVWNTSA-N |
| XLogP | 4.78 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|