C22H15BrN4O5 — CID 135905091
N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 135905091) has the molecular formula C22H15BrN4O5 and a molecular weight of 495.29 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 135905091 |
| Molecular Formula | C22H15BrN4O5 |
| Molecular Weight | 495.29 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | N-[(Z)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N/N=C\c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C22H15BrN4O5/c23-17-10-14(27(31)32)9-13(21(17)29)11-24-25-20(28)12-26-18-7-3-1-5-15(18)22(30)16-6-2-4-8-19(16)26/h1-11,29H,12H2,(H,25,28)/b24-11- |
| InChIKey | RELSPIMTVPSRHT-MYKKPKGFSA-N |
| XLogP | 3.68 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|