C22H16BrN3O4 — CID 137171999
N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 137171999) has the molecular formula C22H16BrN3O4 and a molecular weight of 466.29 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 137171999 |
| Molecular Formula | C22H16BrN3O4 |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | N-[(Z)-(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N/N=C\c1cc(Br)c(O)cc1O |
| InChI | InChI=1S/C22H16BrN3O4/c23-16-9-13(19(27)10-20(16)28)11-24-25-21(29)12-26-17-7-3-1-5-14(17)22(30)15-6-2-4-8-18(15)26/h1-11,27-28H,12H2,(H,25,29)/b24-11- |
| InChIKey | GOJZZDLAGVRMLP-MYKKPKGFSA-N |
| XLogP | 3.48 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|