C22H15Br2N3O3 — CID 135900957
N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 135900957) has the molecular formula C22H15Br2N3O3 and a molecular weight of 529.19 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 135900957 |
| Molecular Formula | C22H15Br2N3O3 |
| Molecular Weight | 529.19 g/mol |
| Exact Mass | 526.95 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)NN=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C22H15Br2N3O3/c23-16-9-13(10-17(24)22(16)30)11-25-26-20(28)12-27-18-7-3-1-5-14(18)21(29)15-6-2-4-8-19(15)27/h1-11,30H,12H2,(H,26,28) |
| InChIKey | GHDXSAYXBVVAFY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|