C24H19Br2N3O3 — CID 98076624
N-[(Z)-(3,5-dibromo-2-ethoxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 98076624) has the molecular formula C24H19Br2N3O3 and a molecular weight of 557.24 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2-ethoxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-2-ethoxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 98076624 |
| Molecular Formula | C24H19Br2N3O3 |
| Molecular Weight | 557.24 g/mol |
| Exact Mass | 554.98 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2-ethoxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | CCOc1c(Br)cc(Br)cc1/C=N\NC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H19Br2N3O3/c1-2-32-24-15(11-16(25)12-19(24)26)13-27-28-22(30)14-29-20-9-5-3-7-17(20)23(31)18-8-4-6-10-21(18)29/h3-13H,2,14H2,1H3,(H,28,30)/b27-13- |
| InChIKey | QRDIXWOFDYRZCI-WKIKZPBSSA-N |
| XLogP | 5.23 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.24 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|