C22H16BrN3O2 — CID 98005141
N-[(Z)-(3-bromophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 98005141) has the molecular formula C22H16BrN3O2 and a molecular weight of 434.29 g/mol. Its IUPAC name is N-[(Z)-(3-bromophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(Z)-(3-bromophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 98005141 |
| Molecular Formula | C22H16BrN3O2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | N-[(Z)-(3-bromophenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C22H16BrN3O2/c23-16-7-5-6-15(12-16)13-24-25-21(27)14-26-19-10-3-1-8-17(19)22(28)18-9-2-4-11-20(18)26/h1-13H,14H2,(H,25,27)/b24-13- |
| InChIKey | NQUZDTFSHDFTDG-CFRMEGHHSA-N |
| XLogP | 4.07 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|