C18H16Br2N4O2 — CID 3105341
N,N'-bis[(3-bromophenyl)methylideneamino]butanediamide (PubChem CID 3105341) has the molecular formula C18H16Br2N4O2 and a molecular weight of 480.16 g/mol. Its IUPAC name is N,N'-bis[(3-bromophenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(3-bromophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3105341 |
| Molecular Formula | C18H16Br2N4O2 |
| Molecular Weight | 480.16 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | N,N'-bis[(3-bromophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)NN=Cc1cccc(Br)c1)NN=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H16Br2N4O2/c19-15-5-1-3-13(9-15)11-21-23-17(25)7-8-18(26)24-22-12-14-4-2-6-16(20)10-14/h1-6,9-12H,7-8H2,(H,23,25)(H,24,26) |
| InChIKey | APNSYQHRHKOMDT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|