C19H19BrN2O2 — CID 172928894
N-[(E)-(3-bromophenyl)methylideneamino]-5-(4-methylphenyl)-4-oxopentanamide (PubChem CID 172928894) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is N-[(E)-(3-bromophenyl)methylideneamino]-5-(4-methylphenyl)-4-oxopentanamide.
| Compound Name | N-[(E)-(3-bromophenyl)methylideneamino]-5-(4-methylphenyl)-4-oxopentanamide |
|---|---|
| PubChem CID | 172928894 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[(E)-(3-bromophenyl)methylideneamino]-5-(4-methylphenyl)-4-oxopentanamide |
| SMILES | Cc1ccc(CC(=O)CCC(=O)N/N=C/c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H19BrN2O2/c1-14-5-7-15(8-6-14)12-18(23)9-10-19(24)22-21-13-16-3-2-4-17(20)11-16/h2-8,11,13H,9-10,12H2,1H3,(H,22,24)/b21-13+ |
| InChIKey | OBNWHCVWEQIKKU-FYJGNVAPSA-N |
| XLogP | 3.80 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|