C17H18BrN3O — CID 6078696
N-[(Z)-(3-bromophenyl)methylideneamino]-2-(2,6-dimethylanilino)acetamide (PubChem CID 6078696) has the molecular formula C17H18BrN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is N-[(Z)-(3-bromophenyl)methylideneamino]-2-(2,6-dimethylanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromophenyl)methylideneamino]-2-(2,6-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 6078696 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(Z)-(3-bromophenyl)methylideneamino]-2-(2,6-dimethylanilino)acetamide |
| SMILES | Cc1cccc(C)c1NCC(=O)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C17H18BrN3O/c1-12-5-3-6-13(2)17(12)19-11-16(22)21-20-10-14-7-4-8-15(18)9-14/h3-10,19H,11H2,1-2H3,(H,21,22)/b20-10- |
| InChIKey | SNIOBUJTSUCULN-JMIUGGIZSA-N |
| XLogP | 3.63 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|