C16H18N4O — CID 6092833
2-(2,6-dimethylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide (PubChem CID 6092833) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-(2,6-dimethylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide.
| Compound Name | 2-(2,6-dimethylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6092833 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(2,6-dimethylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide |
| SMILES | Cc1cccc(C)c1NCC(=O)N/N=C\c1ccncc1 |
| InChI | InChI=1S/C16H18N4O/c1-12-4-3-5-13(2)16(12)18-11-15(21)20-19-10-14-6-8-17-9-7-14/h3-10,18H,11H2,1-2H3,(H,20,21)/b19-10- |
| InChIKey | ZMBFZEPWXLUKSQ-GRSHGNNSSA-N |
| XLogP | 2.26 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|