C18H17Br2N3O2 — CID 5190370
N-(3-bromophenyl)-N'-[(3-bromophenyl)methylideneamino]pentanediamide (PubChem CID 5190370) has the molecular formula C18H17Br2N3O2 and a molecular weight of 467.16 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-[(3-bromophenyl)methylideneamino]pentanediamide.
| Compound Name | N-(3-bromophenyl)-N'-[(3-bromophenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 5190370 |
| Molecular Formula | C18H17Br2N3O2 |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | N-(3-bromophenyl)-N'-[(3-bromophenyl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1cccc(Br)c1)NN=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H17Br2N3O2/c19-14-5-1-4-13(10-14)12-21-23-18(25)9-3-8-17(24)22-16-7-2-6-15(20)11-16/h1-2,4-7,10-12H,3,8-9H2,(H,22,24)(H,23,25) |
| InChIKey | MJUUQUUXPZEEPT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|