C21H22BrN3O3 — CID 126166086
N-(3-bromophenyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]pentanediamide (PubChem CID 126166086) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]pentanediamide.
| Compound Name | N-(3-bromophenyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 126166086 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N-(3-bromophenyl)-N'-[(Z)-(4-prop-2-enoxyphenyl)methylideneamino]pentanediamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)CCCC(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C21H22BrN3O3/c1-2-13-28-19-11-9-16(10-12-19)15-23-25-21(27)8-4-7-20(26)24-18-6-3-5-17(22)14-18/h2-3,5-6,9-12,14-15H,1,4,7-8,13H2,(H,24,26)(H,25,27)/b23-15- |
| InChIKey | UZMVUDNIUXQDAM-HAHDFKILSA-N |
| XLogP | 4.27 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|