C26H22BrN3O2 — CID 4997402
N'-(anthracen-9-ylmethylideneamino)-N-(3-bromophenyl)pentanediamide (PubChem CID 4997402) has the molecular formula C26H22BrN3O2 and a molecular weight of 488.39 g/mol. Its IUPAC name is N'-(anthracen-9-ylmethylideneamino)-N-(3-bromophenyl)pentanediamide.
| Compound Name | N'-(anthracen-9-ylmethylideneamino)-N-(3-bromophenyl)pentanediamide |
|---|---|
| PubChem CID | 4997402 |
| Molecular Formula | C26H22BrN3O2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N'-(anthracen-9-ylmethylideneamino)-N-(3-bromophenyl)pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1cccc(Br)c1)NN=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C26H22BrN3O2/c27-20-9-5-10-21(16-20)29-25(31)13-6-14-26(32)30-28-17-24-22-11-3-1-7-18(22)15-19-8-2-4-12-23(19)24/h1-5,7-12,15-17H,6,13-14H2,(H,29,31)(H,30,32) |
| InChIKey | OVFFHKLUPFBXNC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|