C22H18F3N3O3 — CID 3337739
N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide (PubChem CID 3337739) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide.
| Compound Name | N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 3337739 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide |
| SMILES | O=C(CCC(=O)Nc1cccc(C(F)(F)F)c1)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C22H18F3N3O3/c23-22(24,25)15-5-3-6-16(12-15)27-20(30)10-11-21(31)28-26-13-18-17-7-2-1-4-14(17)8-9-19(18)29/h1-9,12-13,29H,10-11H2,(H,27,30)(H,28,31) |
| InChIKey | PBPANCIMSCGVND-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|