C25H18F3N3O2 — CID 5029379
N'-(anthracen-9-ylmethylideneamino)-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 5029379) has the molecular formula C25H18F3N3O2 and a molecular weight of 449.43 g/mol. Its IUPAC name is N'-(anthracen-9-ylmethylideneamino)-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-(anthracen-9-ylmethylideneamino)-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 5029379 |
| Molecular Formula | C25H18F3N3O2 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N'-(anthracen-9-ylmethylideneamino)-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(C(F)(F)F)c1)NN=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C25H18F3N3O2/c26-25(27,28)18-8-5-9-19(13-18)30-23(32)14-24(33)31-29-15-22-20-10-3-1-6-16(20)12-17-7-2-4-11-21(17)22/h1-13,15H,14H2,(H,30,32)(H,31,33) |
| InChIKey | RIWTUSCNLQVITQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|