C31H23ClN4O2 — CID 92847108
N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 92847108) has the molecular formula C31H23ClN4O2 and a molecular weight of 519.00 g/mol. Its IUPAC name is N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 92847108 |
| Molecular Formula | C31H23ClN4O2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | N-[(Z)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N/N=C\c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C31H23ClN4O2/c32-23-15-13-21(14-16-23)18-35-19-22(24-7-1-4-10-27(24)35)17-33-34-30(37)20-36-28-11-5-2-8-25(28)31(38)26-9-3-6-12-29(26)36/h1-17,19H,18,20H2,(H,34,37)/b33-17- |
| InChIKey | WLRGZZYKXVGSGY-FZPRHHONSA-N |
| XLogP | 5.96 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|