C26H19ClN6O4 — CID 166173213
N-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide (PubChem CID 166173213) has the molecular formula C26H19ClN6O4 and a molecular weight of 514.93 g/mol. Its IUPAC name is N-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | N-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 166173213 |
| Molecular Formula | C26H19ClN6O4 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | N-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]-2-(7-nitro-4-oxoquinazolin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2cc([N+](=O)[O-])ccc2c1=O)N/N=C/c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H19ClN6O4/c27-19-7-5-17(6-8-19)13-31-14-18(21-3-1-2-4-24(21)31)12-29-30-25(34)15-32-16-28-23-11-20(33(36)37)9-10-22(23)26(32)35/h1-12,14,16H,13,15H2,(H,30,34)/b29-12+ |
| InChIKey | ULVWTXPJLWHJEF-XKJRVUDJSA-N |
| XLogP | 4.11 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|