C34H28N4O2 — CID 21212478
N-[(E)-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 21212478) has the molecular formula C34H28N4O2 and a molecular weight of 524.62 g/mol. Its IUPAC name is N-[(E)-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(E)-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 21212478 |
| Molecular Formula | C34H28N4O2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | N-[(E)-[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1cc(/C=N/NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c(C)n1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H28N4O2/c1-23-20-27(24(2)38(23)28-18-16-26(17-19-28)25-10-4-3-5-11-25)21-35-36-33(39)22-37-31-14-8-6-12-29(31)34(40)30-13-7-9-15-32(30)37/h3-21H,22H2,1-2H3,(H,36,39)/b35-21+ |
| InChIKey | VMOMMCYGWIFUIQ-XICOUIIWSA-N |
| XLogP | 6.38 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|