C8H7BrN4O4 — CID 135504406
[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]urea (PubChem CID 135504406) has the molecular formula C8H7BrN4O4 and a molecular weight of 303.07 g/mol. Its IUPAC name is [(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]urea.
| Compound Name | [(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 135504406 |
| Molecular Formula | C8H7BrN4O4 |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | [(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C8H7BrN4O4/c9-6-2-5(13(16)17)1-4(7(6)14)3-11-12-8(10)15/h1-3,14H,(H3,10,12,15)/b11-3+ |
| InChIKey | BAZNWWWZMVGBOG-QDEBKDIKSA-N |
| XLogP | 1.07 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|