C19H22BrN3O4 — CID 135750429
(3S,6R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide (PubChem CID 135750429) has the molecular formula C19H22BrN3O4 and a molecular weight of 436.31 g/mol. Its IUPAC name is (3S,6R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide.
| Compound Name | (3S,6R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide |
|---|---|
| PubChem CID | 135750429 |
| Molecular Formula | C19H22BrN3O4 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (3S,6R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])cc(Br)c1O)C12CC3C[C@@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C19H22BrN3O4/c20-16-6-15(23(26)27)5-14(17(16)24)10-21-22-18(25)19-7-11-1-2-12(8-19)4-13(3-11)9-19/h5-6,10-13,24H,1-4,7-9H2,(H,22,25)/b21-10+/t11-,12+,13?,19? |
| InChIKey | WILUWTLJUAVETM-IVJXHWSKSA-N |
| XLogP | 4.12 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|