C21H22BrN3O4 — CID 136835332
cis-(1S,2R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide (PubChem CID 136835332) has the molecular formula C21H22BrN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136835332 |
| Molecular Formula | C21H22BrN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | cis-(1S,2R)-N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-tert-butylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@@H]2C[C@@H]2C(=O)N/N=C/c2cc([N+](=O)[O-])cc(Br)c2O)cc1 |
| InChI | InChI=1S/C21H22BrN3O4/c1-21(2,3)14-6-4-12(5-7-14)16-10-17(16)20(27)24-23-11-13-8-15(25(28)29)9-18(22)19(13)26/h4-9,11,16-17,26H,10H2,1-3H3,(H,24,27)/b23-11+/t16-,17-/m0/s1 |
| InChIKey | DOIWVXPOGQNOFB-FKDRWTFESA-N |
| XLogP | 4.61 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|