C25H25N3O4 — CID 41290526
trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide (PubChem CID 41290526) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 41290526 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@H]2C[C@@H]2C(=O)N/N=C\c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-25(2,3)18-9-7-16(8-10-18)21-14-22(21)24(29)27-26-15-20-11-12-23(32-20)17-5-4-6-19(13-17)28(30)31/h4-13,15,21-22H,14H2,1-3H3,(H,27,29)/b26-15-/t21-,22+/m1/s1 |
| InChIKey | ASUZAJDUZPDOGZ-DVBTUXLISA-N |
| XLogP | 5.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|