C25H24Cl2N2O2 — CID 40735098
cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide (PubChem CID 40735098) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40735098 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc([C@H]2C[C@H]2C(=O)N/N=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-25(2,3)17-7-4-15(5-8-17)19-13-20(19)24(30)29-28-14-18-9-11-23(31-18)16-6-10-21(26)22(27)12-16/h4-12,14,19-20H,13H2,1-3H3,(H,29,30)/b28-14+/t19-,20-/m1/s1 |
| InChIKey | JMTPSXFSBCCNEQ-FBUPDLHWSA-N |
| XLogP | 6.80 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|