C20H20Cl2N2O2 — CID 11900838
(1S,6S,7S)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 11900838) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is (1S,6S,7S)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S,7S)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 11900838 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (1S,6S,7S)-N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | C[C@]12CCCC[C@H]1[C@@H]2C(=O)N/N=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c1-20-9-3-2-4-14(20)18(20)19(25)24-23-11-13-6-8-17(26-13)12-5-7-15(21)16(22)10-12/h5-8,10-11,14,18H,2-4,9H2,1H3,(H,24,25)/b23-11-/t14-,18+,20-/m0/s1 |
| InChIKey | MUGMYCBDMMTNKL-UHMCQHFASA-N |
| XLogP | 5.53 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|