C21H21N3O6 — CID 126054974
2-[5-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid (PubChem CID 126054974) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-[5-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid.
| Compound Name | 2-[5-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 126054974 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[5-[(Z)-[[(1S,6R,7S)-1-methylbicyclo[4.1.0]heptane-7-carbonyl]hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid |
| SMILES | C[C@]12CCCC[C@@H]1[C@@H]2C(=O)N/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2C(=O)O)o1 |
| InChI | InChI=1S/C21H21N3O6/c1-21-9-3-2-4-16(21)18(21)19(25)23-22-11-13-6-8-17(30-13)14-7-5-12(24(28)29)10-15(14)20(26)27/h5-8,10-11,16,18H,2-4,9H2,1H3,(H,23,25)(H,26,27)/b22-11-/t16-,18-,21+/m1/s1 |
| InChIKey | RXSWFLAXZKCZSX-HOZPHDFGSA-N |
| XLogP | 3.83 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|