C18H13N3O7 — CID 126047375
2-[5-[(Z)-[(5-methylfuran-2-carbonyl)hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid (PubChem CID 126047375) has the molecular formula C18H13N3O7 and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-[5-[(Z)-[(5-methylfuran-2-carbonyl)hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid.
| Compound Name | 2-[5-[(Z)-[(5-methylfuran-2-carbonyl)hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 126047375 |
| Molecular Formula | C18H13N3O7 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[5-[(Z)-[(5-methylfuran-2-carbonyl)hydrazinylidene]methyl]furan-2-yl]-5-nitrobenzoic acid |
| SMILES | Cc1ccc(C(=O)N/N=C\c2ccc(-c3ccc([N+](=O)[O-])cc3C(=O)O)o2)o1 |
| InChI | InChI=1S/C18H13N3O7/c1-10-2-6-16(27-10)17(22)20-19-9-12-4-7-15(28-12)13-5-3-11(21(25)26)8-14(13)18(23)24/h2-9H,1H3,(H,20,22)(H,23,24)/b19-9- |
| InChIKey | ITRQEZXUTLNCJV-OCKHKDLRSA-N |
| XLogP | 3.22 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|