C21H17BrN2O2 — CID 6959158
cis-(1S,2R)-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 6959158) has the molecular formula C21H17BrN2O2 and a molecular weight of 409.28 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6959158 |
| Molecular Formula | C21H17BrN2O2 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | cis-(1S,2R)-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(Br)cc2)o1)[C@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H17BrN2O2/c22-16-8-6-15(7-9-16)20-11-10-17(26-20)13-23-24-21(25)19-12-18(19)14-4-2-1-3-5-14/h1-11,13,18-19H,12H2,(H,24,25)/b23-13-/t18-,19-/m0/s1 |
| InChIKey | SRPXAFRGFMAJCD-HNGNLUIFSA-N |
| XLogP | 4.96 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|